Products 220438-80-2
CAS 220438-80-2 appears in our catalog under these names: Repaglinide EP Impurity A, (4-Carboxy-3-ethoxy)phenyl Acetic Acid, >95% (HPLC), (4-Carboxy-3-ethoxy)phenyl acetic acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 5mg, 2mg, 1mg.
4-(carboxymethyl)-2-ethoxybenzoic acid (CAS 220438-80-2) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 4-(carboxymethyl)-2-ethoxybenzoic acid. InChIKey: PRZWZRNYTRQDLH-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-(carboxymethyl)-2-ethoxybenzoic acid |
| InChIKey | PRZWZRNYTRQDLH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzeneacetic acid, 4-carboxy-3-ethoxy-, 4-Carboxymethyl-2-ethoxybenzoic acid, Repaglinide specified impurity A [EP], REPAGLINIDE IMPURITY A [EP IMPURITY], REPAGLINIDE IMPURITY A (EP IMPURITY), Repaglinide specified impurity A, (4-Carboxy-3-ethoxy)phenyl Acetic Acid, Repaglinide EP Impurity A, Repaglinide Impurity A, 4-Carboxy-3-ethoxybenzeneacetic Acid