Products 2204562-77-4

CAS 2204562-77-4 is the registry number for 5-(2-Hydroxy-ethylcarbamoyl)-pentanoic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-(2-hydroxyethylamino)-6-oxohexanoate (CAS 2204562-77-4) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl 6-(2-hydroxyethylamino)-6-oxohexanoate. InChIKey: MXEDVOJMYJAQRS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO4
Molecular weight245.32 g/mol
IUPAC nametert-butyl 6-(2-hydroxyethylamino)-6-oxohexanoate
InChIKeyMXEDVOJMYJAQRS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CCCCC(=O)NCCO

Computed by PubChem (NCBI)