CAS 22057-45-0 is the registry number for 4-Chloro-2-nitro-1-(phenylmethylthio)benzene. Offered by: Biosynth. Available pack sizes: 25g, 10g.
1-benzylsulfanyl-4-chloro-2-nitrobenzene (CAS 22057-45-0) is a chemical compound with the molecular formula C13H10ClNO2S and a molecular weight of 279.74 g/mol. IUPAC name: 1-benzylsulfanyl-4-chloro-2-nitrobenzene. InChIKey: SQCOCAUVBVCDBO-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2S |
|---|---|
| Molecular weight | 279.74 g/mol |
| IUPAC name | 1-benzylsulfanyl-4-chloro-2-nitrobenzene |
| InChIKey | SQCOCAUVBVCDBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)