Products 422540-99-6

CAS 422540-99-6 is the registry number for 2-[(2-Chlorobenzyl)thio]nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(2-chlorophenyl)methylsulfanyl]pyridine-3-carboxylic acid (CAS 422540-99-6) is a chemical compound with the molecular formula C13H10ClNO2S and a molecular weight of 279.74 g/mol. IUPAC name: 2-[(2-chlorophenyl)methylsulfanyl]pyridine-3-carboxylic acid. InChIKey: SJDXALOFYAUFFG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO2S
Molecular weight279.74 g/mol
IUPAC name2-[(2-chlorophenyl)methylsulfanyl]pyridine-3-carboxylic acid
InChIKeySJDXALOFYAUFFG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CSC2=C(C=CC=N2)C(=O)O)Cl

Computed by PubChem (NCBI)