Products 905978-77-0

CAS 905978-77-0 is the registry number for 9-Methyl-9h-carbazole-3-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

9-methylcarbazole-3-sulfonyl chloride (CAS 905978-77-0) is a chemical compound with the molecular formula C13H10ClNO2S and a molecular weight of 279.74 g/mol. IUPAC name: 9-methylcarbazole-3-sulfonyl chloride. InChIKey: HUGGWTFEJQFFBF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO2S
Molecular weight279.74 g/mol
IUPAC name9-methylcarbazole-3-sulfonyl chloride
InChIKeyHUGGWTFEJQFFBF-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)S(=O)(=O)Cl)C3=CC=CC=C31

Computed by PubChem (NCBI)