Products 69741-45-3

CAS 69741-45-3 is the registry number for Diazoxide Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-benzylsulfanyl-4-chloro-1-nitrobenzene (CAS 69741-45-3) is a chemical compound with the molecular formula C13H10ClNO2S and a molecular weight of 279.74 g/mol. IUPAC name: 2-benzylsulfanyl-4-chloro-1-nitrobenzene. InChIKey: YGVHUHUCUDNMJS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO2S
Molecular weight279.74 g/mol
IUPAC name2-benzylsulfanyl-4-chloro-1-nitrobenzene
InChIKeyYGVHUHUCUDNMJS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CSC2=C(C=CC(=C2)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)