CAS 220628-98-8 appears in our catalog under these names: (S)-4-Isopropyl-2-(quinolin-8-yl)-4,5-dihydrooxazole, 97%, (S)-4-Isopropyl-2-(quinolin-8-yl)-4,5-dihydrooxazole, ≥90%, ≥90%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 50mg, 250mg.
(4S)-4-propan-2-yl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole (CAS 220628-98-8) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: (4S)-4-propan-2-yl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole. InChIKey: YXQCQKAOBOTUEZ-CYBMUJFWSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | (4S)-4-propan-2-yl-2-quinolin-8-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | YXQCQKAOBOTUEZ-CYBMUJFWSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=CC=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)