CAS 2206742-47-2 appears in our catalog under these names: 4-Bromo-5,6-dimethyl-1H-indazole, 97%, 4–Bromo–5,6–dimethyl–1H–indazole, 4-Bromo-5,6-dimethyl-1H-indazole, 97%, 97%, 4-bromo-5,6-dimethyl-2H-indazole, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25mg, 1g, 250mg, 100mg, 500mg, 10g, 25g.
4-bromo-5,6-dimethyl-1H-indazole (CAS 2206742-47-2) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-5,6-dimethyl-1H-indazole. InChIKey: VOZOCXMYGXRZPF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-5,6-dimethyl-1H-indazole |
| InChIKey | VOZOCXMYGXRZPF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=NN2)C(=C1C)Br |
Computed by PubChem (NCBI)