Products 2209078-67-9
CAS 2209078-67-9 is the registry number for rac-(2R,5R)-1-[(tert-butoxy)carbonyl]-5-methylpiperidine-2-carboxylic acid, cis, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(2R,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 2209078-67-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: DXLXYTLOWYXOHQ-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | DXLXYTLOWYXOHQ-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC[C@@H](N(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)