CAS 2227778-65-4 is the registry number for (2S,5R)-1-(tert-butoxycarbonyl)-5-methylpiperidine-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 2227778-65-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: DXLXYTLOWYXOHQ-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S,5R)-5-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | DXLXYTLOWYXOHQ-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)