CAS 22101-90-2 appears in our catalog under these names: 4,4–Diphenylbutylamine hydrochloride, 4,4-Diphenylbutylamine hydrochloride, 4,4-Diphenylbutylamine HCl 99%, 4,4-Diphenylbutylamine (hydrochloride), 99%, 99%, 4,4-Diphenylbutylamine (hydrochloride), 99.00%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 2mg, 5mg, 100mg, 250mg, 1g, 10 mg, 100 mg.
4,4-diphenylbutan-1-amine;hydrochloride (CAS 22101-90-2) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: 4,4-diphenylbutan-1-amine;hydrochloride. InChIKey: MQFLILPZNNSOGK-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | 4,4-diphenylbutan-1-amine;hydrochloride |
| InChIKey | MQFLILPZNNSOGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCCN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)