Products 2210244-83-8
CAS 2210244-83-8 appears in our catalog under these names: FFN246, FFN246, 99.79%, FFN246, 98%. Offered by: GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 100 mg, 50 mg, 5 mg, 10 mg.
7-(2-aminoethyl)-1-fluoro-10H-acridin-9-one (CAS 2210244-83-8) is a chemical compound with the molecular formula C15H13FN2O and a molecular weight of 256.27 g/mol. IUPAC name: 7-(2-aminoethyl)-1-fluoro-10H-acridin-9-one. InChIKey: SMTKPXKSQXDLCY-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2O |
|---|---|
| Molecular weight | 256.27 g/mol |
| IUPAC name | 7-(2-aminoethyl)-1-fluoro-10H-acridin-9-one |
| InChIKey | SMTKPXKSQXDLCY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)C3=C(N2)C=CC(=C3)CCN |
Computed by PubChem (NCBI)