Products 3031763-96-6
CAS 3031763-96-6 is the registry number for (S)-2-[Amino(2-indolyl)methyl]-4-fluorophenol, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
2-[(S)-amino(1H-indol-2-yl)methyl]-4-fluorophenol (CAS 3031763-96-6) is a chemical compound with the molecular formula C15H13FN2O and a molecular weight of 256.27 g/mol. IUPAC name: 2-[(S)-amino(1H-indol-2-yl)methyl]-4-fluorophenol. InChIKey: CNJHYEIMNMQSKO-HNNXBMFYSA-N.
| Molecular formula | C15H13FN2O |
|---|---|
| Molecular weight | 256.27 g/mol |
| IUPAC name | 2-[(S)-amino(1H-indol-2-yl)methyl]-4-fluorophenol |
| InChIKey | CNJHYEIMNMQSKO-HNNXBMFYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)[C@H](C3=C(C=CC(=C3)F)O)N |
Computed by PubChem (NCBI)