CAS 856436-17-4 is the registry number for Sunitinib Impurity 61. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one (CAS 856436-17-4) is a chemical compound with the molecular formula C15H13FN2O and a molecular weight of 256.27 g/mol. IUPAC name: (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one. InChIKey: JDMRJVZLFPJFSD-GHXNOFRVSA-N.
| Molecular formula | C15H13FN2O |
|---|---|
| Molecular weight | 256.27 g/mol |
| IUPAC name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-fluoro-1H-indol-2-one |
| InChIKey | JDMRJVZLFPJFSD-GHXNOFRVSA-N |
| SMILES | CC1=CC(=C(N1)/C=C\2/C3=C(C=CC(=C3)F)NC2=O)C |
Computed by PubChem (NCBI)