CAS 2757083-54-6 is the registry number for (S)-4-Benzyl-2-(5-fluoropyridin-2-yl)-4,5-dihydrooxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg.
(4S)-4-benzyl-2-(5-fluoro-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2757083-54-6) is a chemical compound with the molecular formula C15H13FN2O and a molecular weight of 256.27 g/mol. IUPAC name: (4S)-4-benzyl-2-(5-fluoro-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: HKNNNQGKTMBSHR-ZDUSSCGKSA-N.
| Molecular formula | C15H13FN2O |
|---|---|
| Molecular weight | 256.27 g/mol |
| IUPAC name | (4S)-4-benzyl-2-(5-fluoro-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | HKNNNQGKTMBSHR-ZDUSSCGKSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC=C(C=C2)F)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)