CAS 221238-83-1 is the registry number for SMER10. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one (CAS 221238-83-1) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one. InChIKey: VQMVFISLGPSWGO-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| InChIKey | VQMVFISLGPSWGO-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC3=CC=CC=C3C4=C2C(=O)N(C=N4)N |
Computed by PubChem (NCBI)