CAS 221352-10-9 appears in our catalog under these names: 3,3-Dimethylbenzo[C][1,2]Oxaborol-1(3H)-Ol, 95%, 95%, 3,3-Dimethylbenzo[c][1,2]oxaborol-1(3H)-ol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-hydroxy-3,3-dimethyl-2,1-benzoxaborole (CAS 221352-10-9) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: 1-hydroxy-3,3-dimethyl-2,1-benzoxaborole. InChIKey: XPHBVPSNNPMQPE-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | 1-hydroxy-3,3-dimethyl-2,1-benzoxaborole |
| InChIKey | XPHBVPSNNPMQPE-UHFFFAOYSA-N |
| SMILES | B1(C2=CC=CC=C2C(O1)(C)C)O |
Computed by PubChem (NCBI)