Products 221362-74-9
CAS 221362-74-9 is the registry number for (R)-Isosakuranetin, 99.56%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(2R)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 221362-74-9) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (2R)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: HMUJXQRRKBLVOO-CQSZACIVSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2R)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | HMUJXQRRKBLVOO-CQSZACIVSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2CC(=O)C3=C(C=C(C=C3O2)O)O |
Computed by PubChem (NCBI)