CAS 2216-17-3 appears in our catalog under these names: N,N-Diethyl-o-nitroaniline, 98%, N,N-Diethyl-2-nitroaniline 98%, N,N-Diethyl-o-nitroaniline, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
N,N-diethyl-2-nitroaniline (CAS 2216-17-3) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N,N-diethyl-2-nitroaniline. InChIKey: BUBRUAQVAPTGHV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N,N-diethyl-2-nitroaniline |
| InChIKey | BUBRUAQVAPTGHV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)