CAS 22162-19-2 is the registry number for (4-Nitro-1,2-phenylene)dimethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-(hydroxymethyl)-4-nitrophenyl]methanol (CAS 22162-19-2) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: [2-(hydroxymethyl)-4-nitrophenyl]methanol. InChIKey: BVWREOCJVMLGTJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | [2-(hydroxymethyl)-4-nitrophenyl]methanol |
| InChIKey | BVWREOCJVMLGTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CO)CO |
Computed by PubChem (NCBI)