Products 2216746-83-5
CAS 2216746-83-5 appears in our catalog under these names: 5-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97%, 5-bromo-2,4-dichloro-pyrrolo[2,1-f][1,2,4]triazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
5-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 2216746-83-5) is a chemical compound with the molecular formula C6H2BrCl2N3 and a molecular weight of 266.91 g/mol. IUPAC name: 5-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: AHSHMRVLPMSFJP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2N3 |
|---|---|
| Molecular weight | 266.91 g/mol |
| IUPAC name | 5-bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | AHSHMRVLPMSFJP-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Br)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)