Products 221675-45-2
CAS 221675-45-2 appears in our catalog under these names: 5,7-Dimethyl-1h-indole-2-carboxylic acid, 95%, 1H-Indole-2-carboxylic acid, 5,7-dimethyl-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5,7-dimethyl-1H-indole-2-carboxylic acid (CAS 221675-45-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 5,7-dimethyl-1H-indole-2-carboxylic acid. InChIKey: YMOJFBVIUIJKJS-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5,7-dimethyl-1H-indole-2-carboxylic acid |
| InChIKey | YMOJFBVIUIJKJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(N2)C(=O)O)C |
Computed by PubChem (NCBI)