Products 22187-87-7
CAS 22187-87-7 is the registry number for [2,2′-Bipyrrole]-5-carboxaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(1H-pyrrol-2-yl)-1H-pyrrole-2-carbaldehyde (CAS 22187-87-7) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-(1H-pyrrol-2-yl)-1H-pyrrole-2-carbaldehyde. InChIKey: PHIQNHXVGUSEEF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-(1H-pyrrol-2-yl)-1H-pyrrole-2-carbaldehyde |
| InChIKey | PHIQNHXVGUSEEF-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C2=CC=C(N2)C=O |
Computed by PubChem (NCBI)