Products 2219353-93-0
CAS 2219353-93-0 is the registry number for (1S)-2-Amino-1-(3-fluorophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-2-amino-1-(3-fluorophenyl)ethanol;hydrochloride (CAS 2219353-93-0) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: (1S)-2-amino-1-(3-fluorophenyl)ethanol;hydrochloride. InChIKey: WKSRRMYMQDUSBG-DDWIOCJRSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | (1S)-2-amino-1-(3-fluorophenyl)ethanol;hydrochloride |
| InChIKey | WKSRRMYMQDUSBG-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@@H](CN)O.Cl |
Computed by PubChem (NCBI)