Products 2219371-76-1
CAS 2219371-76-1 is the registry number for 1-(3-Carboxyphenyl)-6-oxo-1,4,5,6-tetrahydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(3-carboxyphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (CAS 2219371-76-1) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: 1-(3-carboxyphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid. InChIKey: RFLFSLZAWQEXIC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | 1-(3-carboxyphenyl)-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| InChIKey | RFLFSLZAWQEXIC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(N=C1C(=O)O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)