CAS 2219374-44-2 is the registry number for 2-Amino-2-(3,5-dimethylphenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride (CAS 2219374-44-2) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: 2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride. InChIKey: MQNJYROXNDYVKS-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | 2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride |
| InChIKey | MQNJYROXNDYVKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(CO)N)C.Cl |
Computed by PubChem (NCBI)