Products 2411592-34-0
CAS 2411592-34-0 is the registry number for (R)–2–Amino–2–(3，5–dimethylphenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride (CAS 2411592-34-0) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (2R)-2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride. InChIKey: MQNJYROXNDYVKS-PPHPATTJSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,5-dimethylphenyl)ethanol;hydrochloride |
| InChIKey | MQNJYROXNDYVKS-PPHPATTJSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@H](CO)N)C.Cl |
Computed by PubChem (NCBI)