CAS 2219375-06-9 is the registry number for 5-Phenyl-1,3-oxazole-4-carbothioamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-phenyl-1,3-oxazole-4-carbothioamide (CAS 2219375-06-9) is a chemical compound with the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. IUPAC name: 5-phenyl-1,3-oxazole-4-carbothioamide. InChIKey: FTPLTLMVTDUQIS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2OS |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 5-phenyl-1,3-oxazole-4-carbothioamide |
| InChIKey | FTPLTLMVTDUQIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CO2)C(=S)N |
Computed by PubChem (NCBI)