CAS 22203-98-1 appears in our catalog under these names: SARS-CoV-2-IN-14/ 99.3% (existing batch purity), SARS–CoV–2–IN–14, 5-Chloro-N-(3-chlorophenyl)-2-hydroxybenzamide, SARS-CoV-2-IN-14, 99.02%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 200mg, 10 mg.
5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide (CAS 22203-98-1) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: 5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide. InChIKey: NXDGLRGDIKDWIF-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide |
| InChIKey | NXDGLRGDIKDWIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)