CAS 2221812-28-6 is the registry number for 2-(2-Bromo-6-fluoro-4-methylphenyl)-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-(2-bromo-6-fluoro-4-methylphenyl)-1,3-dioxolane (CAS 2221812-28-6) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: 2-(2-bromo-6-fluoro-4-methylphenyl)-1,3-dioxolane. InChIKey: UXAFATGMVNKRKX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2-(2-bromo-6-fluoro-4-methylphenyl)-1,3-dioxolane |
| InChIKey | UXAFATGMVNKRKX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)C2OCCO2)F |
Computed by PubChem (NCBI)