CAS 22220-03-7 is the registry number for Tadalafil Impurity 84. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 22220-03-7) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: (2R)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: PCGKHZTZDMCZNE-SNVBAGLBSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | (2R)-3-(1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | PCGKHZTZDMCZNE-SNVBAGLBSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)