CAS 1004193-78-5 is the registry number for 1-(3-Trifluoromethyl-phenoxymethyl)-1 H -pyrazole-3-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate (CAS 1004193-78-5) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: methyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate. InChIKey: OVOUTNXAAWPRPF-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | methyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate |
| InChIKey | OVOUTNXAAWPRPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C=C1)COC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)