Products 1004193-78-5

CAS 1004193-78-5 is the registry number for 1-(3-Trifluoromethyl-phenoxymethyl)-1 H -pyrazole-3-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate (CAS 1004193-78-5) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: methyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate. InChIKey: OVOUTNXAAWPRPF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11F3N2O3
Molecular weight300.23 g/mol
IUPAC namemethyl 1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazole-3-carboxylate
InChIKeyOVOUTNXAAWPRPF-UHFFFAOYSA-N
SMILESCOC(=O)C1=NN(C=C1)COC2=CC=CC(=C2)C(F)(F)F

Computed by PubChem (NCBI)