Products 379241-52-8
CAS 379241-52-8 is the registry number for Ethyl 4-hydroxy-1-(3-(trifluoromethyl)phenyl)-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
Ethyl 4-hydroxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate (CAS 379241-52-8) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: ethyl 4-hydroxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate. InChIKey: CONGTUAXDPAEBR-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | ethyl 4-hydroxy-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
| InChIKey | CONGTUAXDPAEBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1O)C2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)