Products 126910-31-4
CAS 126910-31-4 appears in our catalog under these names: H-Ala-AFC, H–Ala–AFC, H-Ala-AFC trifluoroacetate salt. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 0,005g, 0,002g, 0,01g, 0,025g, 0,05g.
2-amino-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]propanamide (CAS 126910-31-4) is a chemical compound with the molecular formula C13H11F3N2O3 and a molecular weight of 300.23 g/mol. IUPAC name: 2-amino-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]propanamide. InChIKey: XOLSUKMEFPGXNO-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O3 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | 2-amino-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]propanamide |
| InChIKey | XOLSUKMEFPGXNO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C(F)(F)F)N |
Computed by PubChem (NCBI)