Products 22226-37-5
CAS 22226-37-5 is the registry number for Atropine Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate (CAS 22226-37-5) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate. InChIKey: RMBZQGMKGCCRKF-PJPHBNEVSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate |
| InChIKey | RMBZQGMKGCCRKF-PJPHBNEVSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)