Products 22236-06-2
CAS 22236-06-2 is the registry number for 2-(Difluoromethoxy)-4-nitroaniline, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(difluoromethoxy)-4-nitroaniline (CAS 22236-06-2) is a chemical compound with the molecular formula C7H6F2N2O3 and a molecular weight of 204.13 g/mol. IUPAC name: 2-(difluoromethoxy)-4-nitroaniline. InChIKey: HAPKGVHPTPDQFC-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O3 |
|---|---|
| Molecular weight | 204.13 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4-nitroaniline |
| InChIKey | HAPKGVHPTPDQFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OC(F)F)N |
Computed by PubChem (NCBI)