CAS 2225152-39-4 is the registry number for 3–(Piperidin–3–yl)–5–fluorophenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(3-fluoro-5-piperidin-3-ylphenyl)boronic acid (CAS 2225152-39-4) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: (3-fluoro-5-piperidin-3-ylphenyl)boronic acid. InChIKey: VYVUOFVQUHSTEM-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (3-fluoro-5-piperidin-3-ylphenyl)boronic acid |
| InChIKey | VYVUOFVQUHSTEM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C2CCCNC2)(O)O |
Computed by PubChem (NCBI)