CAS 2225169-82-2 is the registry number for 3–(tert–Butyl)–5–(pyridin–4–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-tert-butyl-5-pyridin-4-ylphenyl)boronic acid (CAS 2225169-82-2) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: (3-tert-butyl-5-pyridin-4-ylphenyl)boronic acid. InChIKey: CSTDWPJHQAFKHR-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | (3-tert-butyl-5-pyridin-4-ylphenyl)boronic acid |
| InChIKey | CSTDWPJHQAFKHR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)(C)C)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)