CAS 2225179-28-0 is the registry number for (2–methyl–4–(piperazin–1–yl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
(2-methyl-4-piperazin-1-ylphenyl)boronic acid (CAS 2225179-28-0) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: (2-methyl-4-piperazin-1-ylphenyl)boronic acid. InChIKey: DVHYZWOBTZILLK-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | (2-methyl-4-piperazin-1-ylphenyl)boronic acid |
| InChIKey | DVHYZWOBTZILLK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCNCC2)C)(O)O |
Computed by PubChem (NCBI)