Products 2225180-19-6
CAS 2225180-19-6 is the registry number for (3-(4-Methylpiperidin-1-yl)phenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[3-(4-methylpiperidin-1-yl)phenyl]boronic acid (CAS 2225180-19-6) is a chemical compound with the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. IUPAC name: [3-(4-methylpiperidin-1-yl)phenyl]boronic acid. InChIKey: HCHJYQRLNVVTHR-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2 |
|---|---|
| Molecular weight | 219.09 g/mol |
| IUPAC name | [3-(4-methylpiperidin-1-yl)phenyl]boronic acid |
| InChIKey | HCHJYQRLNVVTHR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)