Products 2225180-92-5
CAS 2225180-92-5 appears in our catalog under these names: 2–Fluoro–4–(piperidin–1–yl)phenylboronic acid, (2-Fluoro-4-(piperidin-1-yl)phenyl)boronic acid, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g.
(2-fluoro-4-piperidin-1-ylphenyl)boronic acid (CAS 2225180-92-5) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: (2-fluoro-4-piperidin-1-ylphenyl)boronic acid. InChIKey: ZFKVUQCBOBUAAK-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (2-fluoro-4-piperidin-1-ylphenyl)boronic acid |
| InChIKey | ZFKVUQCBOBUAAK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)