Products 2225181-87-1
CAS 2225181-87-1 is the registry number for tert-Butyl 3-((E)-N'-hydroxycarbamimidoyl)bicyclo(1.1.1)pentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]bicyclo[1.1.1]pentane-1-carboxylate (CAS 2225181-87-1) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]bicyclo[1.1.1]pentane-1-carboxylate. InChIKey: SCSGEZRXPDGOCX-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]bicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | SCSGEZRXPDGOCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CC(C1)(C2)/C(=N/O)/N |
Computed by PubChem (NCBI)