Products 2226204-96-0
CAS 2226204-96-0 is the registry number for 4,8-Diaminonaphthalene-2,6-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,8-diaminonaphthalene-2,6-dicarboxylic acid (CAS 2226204-96-0) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 4,8-diaminonaphthalene-2,6-dicarboxylic acid. InChIKey: SAZJFJGPDGMYJB-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 4,8-diaminonaphthalene-2,6-dicarboxylic acid |
| InChIKey | SAZJFJGPDGMYJB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CC(=C2)C(=O)O)N)N)C(=O)O |
Computed by PubChem (NCBI)