CAS 22272-48-6 appears in our catalog under these names: 3-Benzyl-phenol, 3-Benzylphenol 95%, 3-Benzylphenol, 95%, 95%, 3-Benzylphenol, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g.
3-benzylphenol (CAS 22272-48-6) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 3-benzylphenol. InChIKey: JKFDELMIGLPLAX-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 3-benzylphenol |
| InChIKey | JKFDELMIGLPLAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)