Products 2227204-94-4

CAS 2227204-94-4 is the registry number for Methyl 3-(aminomethyl)cyclopentane-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-(aminomethyl)cyclopentane-1-carboxylate;hydrochloride (CAS 2227204-94-4) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl 3-(aminomethyl)cyclopentane-1-carboxylate;hydrochloride. InChIKey: XPNOQSXPJNFFBC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC namemethyl 3-(aminomethyl)cyclopentane-1-carboxylate;hydrochloride
InChIKeyXPNOQSXPJNFFBC-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(C1)CN.Cl

Computed by PubChem (NCBI)