CAS 2227205-79-8 appears in our catalog under these names: Di-tert-butyl 2,3-dihydropyrazine-1,4-dicarboxylate, 97%, Di-tert-butyl 2,3-dihydropyrazine-1,4-dicarboxylate, 97%, 97%, 1,4-Di-tert-Butyl 1,2,3,4-tetrahydropyrazine-1,4-dicarboxylate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.
Ditert-butyl 2,3-dihydropyrazine-1,4-dicarboxylate (CAS 2227205-79-8) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: ditert-butyl 2,3-dihydropyrazine-1,4-dicarboxylate. InChIKey: DLWPFKKODFIEKS-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | ditert-butyl 2,3-dihydropyrazine-1,4-dicarboxylate |
| InChIKey | DLWPFKKODFIEKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)