CAS 2227206-30-4 is the registry number for 1-(Boc-amino)-4-aminobicyclo(2.2.1)heptane hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Tert-butyl N-(4-amino-1-bicyclo[2.2.1]heptanyl)carbamate;hydrochloride (CAS 2227206-30-4) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl N-(4-amino-1-bicyclo[2.2.1]heptanyl)carbamate;hydrochloride. InChIKey: ZTXRZQNQGAZOQM-UHFFFAOYSA-N.
| Molecular formula | C12H23ClN2O2 |
|---|---|
| Molecular weight | 262.77 g/mol |
| IUPAC name | tert-butyl N-(4-amino-1-bicyclo[2.2.1]heptanyl)carbamate;hydrochloride |
| InChIKey | ZTXRZQNQGAZOQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(C1)(CC2)N.Cl |
Computed by PubChem (NCBI)