Products 2227257-33-0
CAS 2227257-33-0 is the registry number for (1S,2R,5R)-3-Azabicyclo[3.1.0]hexane-2-carboxylic Acid Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S,2R,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride (CAS 2227257-33-0) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (1S,2R,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride. InChIKey: KWBHCTGCOVQKMK-ASMLCRKRSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (1S,2R,5R)-3-azabicyclo[3.1.0]hexane-2-carboxylic acid;hydrochloride |
| InChIKey | KWBHCTGCOVQKMK-ASMLCRKRSA-N |
| SMILES | C1[C@@H]2[C@H]1[C@@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)