CAS 222737-88-4 appears in our catalog under these names: (S)–1–(4–Isopropylphenyl)ethanamine hydrochloride, (S)-1-(4-Isopropylphenyl)ethanamine hydrochloride 97%, (S)-1-(4-Isopropylphenyl)ethanaMine hydrochloride, 97%, 97%, (S)-1-(4-Isopropylphenyl)ethan-1-amine hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(1S)-1-(4-propan-2-ylphenyl)ethanamine;hydrochloride (CAS 222737-88-4) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1S)-1-(4-propan-2-ylphenyl)ethanamine;hydrochloride. InChIKey: LMSMWEMLBQTBPN-FVGYRXGTSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1S)-1-(4-propan-2-ylphenyl)ethanamine;hydrochloride |
| InChIKey | LMSMWEMLBQTBPN-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(C)C)N.Cl |
Computed by PubChem (NCBI)