CAS 2227885-62-1 appears in our catalog under these names: trans–2–(2–ethylphenyl)cyclopropan–1–amine hydrochloride, rac-(1R,2S)-2-(2-ethylphenyl)cyclopropan-1-amine. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
Trans-(1R,2S)-2-(2-ethylphenyl)cyclopropan-1-amine;hydrochloride (CAS 2227885-62-1) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: trans-(1R,2S)-2-(2-ethylphenyl)cyclopropan-1-amine;hydrochloride. InChIKey: PRKYOYIAGMYHGL-VZXYPILPSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2-ethylphenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | PRKYOYIAGMYHGL-VZXYPILPSA-N |
| SMILES | CCC1=CC=CC=C1[C@@H]2C[C@H]2N.Cl |
Computed by PubChem (NCBI)